Boronic acid derivatives
Medchemexpress LLC Cyclopentylboronic acid | 63076-51-7 | 113.95 | 25 G
Cyclopentylboronic acid is a biochemical reagent intended for life science related research, functioning as a biological material or organic compound. It is for research use only and not sold to patients.
- Appearance: White to off-white solid
- Molecular formula: C5H11BO2
- Molecular weight: 113.95
- Purity: ≥97.0% (NMR)
- CAS number: 63076-51-7
- Melting point: 126°C
- Boiling point: 235°C at 760 mmHg
Aobchem 3-Chloro-5-ethoxyphenylboronic acid | ≥95% | CAS 1256345-73-9 | C8H10BClO3 | 5g
3-Chloro-5-ethoxyphenylboronic acid | ≥95% | CAS 1256345-73-9 | C8H10BClO3 | 5g
Aobchem 2 5-Dibromo-4-pyridinylboronic acid pinacol ester | ≥97% | CAS 1451391-18-6 | C11H14BBr2NO2 | 250mg
2 5-Dibromo-4-pyridinylboronic acid pinacol ester | ≥97% | CAS 1451391-18-6 | C11H14BBr2NO2 | 250mg
Aobchem 3 4-Dichloro-2-fluorophenylboronic acid | ≥97% | CAS 1160561-29-4 | C6H4BCl2FO2 | 1g
3 4-Dichloro-2-fluorophenylboronic acid | ≥97% | CAS 1160561-29-4 | C6H4BCl2FO2 | 1g
Aobchem 2-Bromo-4-methoxyphenylboronic acid pinacol ester | 97% | CAS 3025763-18-9 | C13H18BBrO3 | 500mg
2-Bromo-4-methoxyphenylboronic acid pinacol ester | 97% | CAS 3025763-18-9 | C13H18BBrO3 | 500mg
Aobchem 2-Cyano-3-fluorophenylboronic acid | ≥97% | CAS 1218993-03-3 | C7H5BFNO2 | 1g
2-Cyano-3-fluorophenylboronic acid | ≥97% | CAS 1218993-03-3 | C7H5BFNO2 | 1g
eMolecules 126747-14-6 | (4-cyanophenyl)boronic acid | Pharmablock | MFCD01318968 | 146.940 | C7H6BNO2 | 97.000 | OB(O)c1ccc(cc1)C#N | 2.5g | 686926766
(4-cyanophenyl)boronic acid | Pharmablock | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 97.000 | OB(O)c1ccc(cc1)C#N | 2.5g | 686926766
eMolecules 13031-41-9 | 4-Acetoxybenzonitrile | Oakwood Chemical | MFCD00129158 | 161.160 | C9H7NO2 | 97.000 | CC(=O)Oc1ccc(cc1)C#N | 1g | 537705849
4-Acetoxybenzonitrile | Oakwood Chemical | 13031-41-9 | MFCD00129158 | 161.160 | C9H7NO2 | 97.000 | CC(=O)Oc1ccc(cc1)C#N | 1g | 537705849
eMolecules 1256360-37-8 | 3-Bromomethyl-2-fluorophenylboronic acid, pinacol ester | Combi-Blocks | MFCD17214291 | 314.990 | C13H17BBrFO2 | 98.000 | CC1(C)OB(OC1(C)C)c1cccc(CBr)c1F | 1g | 117546036
3-Bromomethyl-2-fluorophenylboronic acid, pinacol ester | Combi-Blocks | 1256360-37-8 | MFCD17214291 | 314.990 | C13H17BBrFO2 | 98.000 | CC1(C)OB(OC1(C)C)c1cccc(CBr)c1F | 1g | 117546036
Chem-Impex International, Inc. Phenylboronic acid | MFCD00002103 | 250G
Phenylboronic acid, MFCD00002103, 250G
eMolecules 1217500-67-8 | 3-Chloro-2-cyanophenylboronic acid | Combi-Blocks | MFCD10696670 | 181.380 | C7H5BClNO2 | 95.000 | OB(O)c1cccc(Cl)c1C#N | 1g | 117524071
3-Chloro-2-cyanophenylboronic acid | Combi-Blocks | 1217500-67-8 | MFCD10696670 | 181.380 | C7H5BClNO2 | 95.000 | OB(O)c1cccc(Cl)c1C#N | 1g | 117524071
eMolecules 126747-14-6 | 4-Cyanophenylboronic acid | Synthonix - Stock | MFCD01318968 | 146.940 | C7H6BNO2 | 97.000 | OB(O)c1ccc(cc1)C#N | 1g | 525912881
4-Cyanophenylboronic acid | Synthonix - Stock | 126747-14-6 | MFCD01318968 | 146.940 | C7H6BNO2 | 97.000 | OB(O)c1ccc(cc1)C#N | 1g | 525912881
Cayman Chemical 19 RHETE Fatty Acids and Deriv
A potent vasodilator of renal arterioles; 30% of the metabolite composition of arachidonic acid by CYP2E1; potent vasodilator of renal preglomerular vessels; blocks 20-HETE-induced vasoconstriction of renal arterioles at 1 µM
eMolecules 768-35-4 | (3-Fluorophenyl)boronic acid | Synthonix - Stock | MFCD00236042 | 139.920 | C6H6BFO2 | 98.000 | OB(O)c1cccc(F)c1 | 1g | 487610214
(3-Fluorophenyl)boronic acid | Synthonix - Stock | 768-35-4 | MFCD00236042 | 139.920 | C6H6BFO2 | 98.000 | OB(O)c1cccc(F)c1 | 1g | 487610214
eMolecules 58885-58-8 | 3-(tert-Butoxycarbonylamino)-1-propanol | Ambeed | MFCD00191883 | 175.228 | C8H17NO3 | 97.000 | CC(C)(C)OC(=O)NCCCO | 10g | 534082896
3-(tert-Butoxycarbonylamino)-1-propanol | Ambeed | 58885-58-8 | MFCD00191883 | 175.228 | C8H17NO3 | 97.000 | CC(C)(C)OC(=O)NCCCO | 10g | 534082896